C13H19Cl2N4O2P — CID 13381611
3,4-dichloro-N-[morpholin-4-yl-(2-propan-2-ylidenehydrazinyl)phosphoryl]aniline (PubChem CID 13381611) has the molecular formula C13H19Cl2N4O2P and a molecular weight of 365.20 g/mol. Its IUPAC name is 3,4-dichloro-N-[morpholin-4-yl-(2-propan-2-ylidenehydrazinyl)phosphoryl]aniline.
| Compound Name | 3,4-dichloro-N-[morpholin-4-yl-(2-propan-2-ylidenehydrazinyl)phosphoryl]aniline |
|---|---|
| PubChem CID | 13381611 |
| Molecular Formula | C13H19Cl2N4O2P |
| Molecular Weight | 365.20 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 3,4-dichloro-N-[morpholin-4-yl-(2-propan-2-ylidenehydrazinyl)phosphoryl]aniline |
| SMILES | CC(C)=NNP(=O)(Nc1ccc(Cl)c(Cl)c1)N1CCOCC1 |
| InChI | InChI=1S/C13H19Cl2N4O2P/c1-10(2)16-18-22(20,19-5-7-21-8-6-19)17-11-3-4-12(14)13(15)9-11/h3-4,9H,5-8H2,1-2H3,(H2,17,18,20) |
| InChIKey | INXOMVLSECICLZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.20 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|