C19H18F4N4O3S — CID 139471292
N-(3-cyano-4-fluorophenyl)-7-methyl-1-oxo-3-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide (PubChem CID 139471292) has the molecular formula C19H18F4N4O3S and a molecular weight of 458.44 g/mol. Its IUPAC name is N-(3-cyano-4-fluorophenyl)-7-methyl-1-oxo-3-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide.
| Compound Name | N-(3-cyano-4-fluorophenyl)-7-methyl-1-oxo-3-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
|---|---|
| PubChem CID | 139471292 |
| Molecular Formula | C19H18F4N4O3S |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | N-(3-cyano-4-fluorophenyl)-7-methyl-1-oxo-3-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
| SMILES | Cn1cc2c(c1C(=O)Nc1ccc(F)c(C#N)c1)CCC(C(C)(O)C(F)(F)F)NS2=O |
| InChI | InChI=1S/C19H18F4N4O3S/c1-18(29,19(21,22)23)15-6-4-12-14(31(30)26-15)9-27(2)16(12)17(28)25-11-3-5-13(20)10(7-11)8-24/h3,5,7,9,15,26,29H,4,6H2,1-2H3,(H,25,28) |
| InChIKey | HOLCSRGDNQJCKH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 107.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |