C25H33F3N4 — CID 139471468
N-[(Z)-2-(4-benzylpiperazin-1-yl)-2-ethylhex-3-enyl]-6-(trifluoromethyl)pyridin-2-amine (PubChem CID 139471468) has the molecular formula C25H33F3N4 and a molecular weight of 446.56 g/mol. Its IUPAC name is N-[(Z)-2-(4-benzylpiperazin-1-yl)-2-ethylhex-3-enyl]-6-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(Z)-2-(4-benzylpiperazin-1-yl)-2-ethylhex-3-enyl]-6-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 139471468 |
| Molecular Formula | C25H33F3N4 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | N-[(Z)-2-(4-benzylpiperazin-1-yl)-2-ethylhex-3-enyl]-6-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC/C=C\C(CC)(CNc1cccc(C(F)(F)F)n1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H33F3N4/c1-3-5-14-24(4-2,20-29-23-13-9-12-22(30-23)25(26,27)28)32-17-15-31(16-18-32)19-21-10-7-6-8-11-21/h5-14H,3-4,15-20H2,1-2H3,(H,29,30)/b14-5- |
| InChIKey | DRCROESLWPPOJP-RZNTYIFUSA-N |
| XLogP | 5.45 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|