C18H35N3O — CID 139471491
2-methyl-2-[4-(3-methylbutyl)piperazin-1-yl]-4-[(2-methylpropan-2-yl)oxy]butanenitrile (PubChem CID 139471491) has the molecular formula C18H35N3O and a molecular weight of 309.50 g/mol. Its IUPAC name is 2-methyl-2-[4-(3-methylbutyl)piperazin-1-yl]-4-[(2-methylpropan-2-yl)oxy]butanenitrile.
| Compound Name | 2-methyl-2-[4-(3-methylbutyl)piperazin-1-yl]-4-[(2-methylpropan-2-yl)oxy]butanenitrile |
|---|---|
| PubChem CID | 139471491 |
| Molecular Formula | C18H35N3O |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.28 |
| IUPAC Name | 2-methyl-2-[4-(3-methylbutyl)piperazin-1-yl]-4-[(2-methylpropan-2-yl)oxy]butanenitrile |
| SMILES | CC(C)CCN1CCN(C(C)(C#N)CCOC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H35N3O/c1-16(2)7-9-20-10-12-21(13-11-20)18(6,15-19)8-14-22-17(3,4)5/h16H,7-14H2,1-6H3 |
| InChIKey | ZGEHBZSTRHBXMC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 39.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |