C29H26N6O3 — CID 139471678
[(Z)-3-[4-amino-3-(5-hydroxy-6-methyl-3-pyridinyl)pyrazolo[3,4-d]pyrimidin-1-yl]-1-(2-methylphenyl)-1-phenylbut-1-en-2-yl] formate (PubChem CID 139471678) has the molecular formula C29H26N6O3 and a molecular weight of 506.57 g/mol. Its IUPAC name is [(Z)-3-[4-amino-3-(5-hydroxy-6-methyl-3-pyridinyl)pyrazolo[3,4-d]pyrimidin-1-yl]-1-(2-methylphenyl)-1-phenylbut-1-en-2-yl] formate.
| Compound Name | [(Z)-3-[4-amino-3-(5-hydroxy-6-methyl-3-pyridinyl)pyrazolo[3,4-d]pyrimidin-1-yl]-1-(2-methylphenyl)-1-phenylbut-1-en-2-yl] formate |
|---|---|
| PubChem CID | 139471678 |
| Molecular Formula | C29H26N6O3 |
| Molecular Weight | 506.57 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | [(Z)-3-[4-amino-3-(5-hydroxy-6-methyl-3-pyridinyl)pyrazolo[3,4-d]pyrimidin-1-yl]-1-(2-methylphenyl)-1-phenylbut-1-en-2-yl] formate |
| SMILES | Cc1ccccc1/C(=C(\OC=O)C(C)n1nc(-c2cnc(C)c(O)c2)c2c(N)ncnc21)c1ccccc1 |
| InChI | InChI=1S/C29H26N6O3/c1-17-9-7-8-12-22(17)24(20-10-5-4-6-11-20)27(38-16-36)19(3)35-29-25(28(30)32-15-33-29)26(34-35)21-13-23(37)18(2)31-14-21/h4-16,19,37H,1-3H3,(H2,30,32,33)/b27-24- |
| InChIKey | ZWLVCEYKGPRRCV-PNHLSOANSA-N |
| XLogP | 4.99 |
| TPSA | 129.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.57 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|