C32H30FN5O3 — CID 139471728
[(Z)-3-[4-amino-3-(3-fluoro-4-propan-2-yloxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]-1-(2-methylphenyl)-1-phenylbut-1-en-2-yl] formate (PubChem CID 139471728) has the molecular formula C32H30FN5O3 and a molecular weight of 551.62 g/mol. Its IUPAC name is [(Z)-3-[4-amino-3-(3-fluoro-4-propan-2-yloxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]-1-(2-methylphenyl)-1-phenylbut-1-en-2-yl] formate.
| Compound Name | [(Z)-3-[4-amino-3-(3-fluoro-4-propan-2-yloxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]-1-(2-methylphenyl)-1-phenylbut-1-en-2-yl] formate |
|---|---|
| PubChem CID | 139471728 |
| Molecular Formula | C32H30FN5O3 |
| Molecular Weight | 551.62 g/mol |
| Exact Mass | 551.23 |
| IUPAC Name | [(Z)-3-[4-amino-3-(3-fluoro-4-propan-2-yloxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]-1-(2-methylphenyl)-1-phenylbut-1-en-2-yl] formate |
| SMILES | Cc1ccccc1/C(=C(\OC=O)C(C)n1nc(-c2ccc(OC(C)C)c(F)c2)c2c(N)ncnc21)c1ccccc1 |
| InChI | InChI=1S/C32H30FN5O3/c1-19(2)41-26-15-14-23(16-25(26)33)29-28-31(34)35-17-36-32(28)38(37-29)21(4)30(40-18-39)27(22-11-6-5-7-12-22)24-13-9-8-10-20(24)3/h5-19,21H,1-4H3,(H2,34,35,36)/b30-27- |
| InChIKey | TWDVRELTRZWNPH-IKPAITLHSA-N |
| XLogP | 6.50 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.62 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|