C26H44O4 — CID 139472252
[5-ethyl-10-methyl-5-[(5-methyl-4-oxohex-5-enoxy)methyl]undec-10-enyl] 2-methylprop-2-enoate (PubChem CID 139472252) has the molecular formula C26H44O4 and a molecular weight of 420.63 g/mol. Its IUPAC name is [5-ethyl-10-methyl-5-[(5-methyl-4-oxohex-5-enoxy)methyl]undec-10-enyl] 2-methylprop-2-enoate.
| Compound Name | [5-ethyl-10-methyl-5-[(5-methyl-4-oxohex-5-enoxy)methyl]undec-10-enyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139472252 |
| Molecular Formula | C26H44O4 |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 420.32 |
| IUPAC Name | [5-ethyl-10-methyl-5-[(5-methyl-4-oxohex-5-enoxy)methyl]undec-10-enyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)CCCCC(CC)(CCCCOC(=O)C(=C)C)COCCCC(=O)C(=C)C |
| InChI | InChI=1S/C26H44O4/c1-8-26(16-10-9-14-21(2)3,17-11-12-19-30-25(28)23(6)7)20-29-18-13-15-24(27)22(4)5/h2,4,6,8-20H2,1,3,5,7H3 |
| InChIKey | QYBGNRZHTLFTSX-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|