C23H24N6O2S — CID 139475057
2-(2-ethylsulfonyl-1,3-dihydroisoindol-5-yl)-N-[4-[(3Z)-3-hydrazinylideneprop-1-en-2-yl]phenyl]pyrimidin-4-amine (PubChem CID 139475057) has the molecular formula C23H24N6O2S and a molecular weight of 448.55 g/mol. Its IUPAC name is 2-(2-ethylsulfonyl-1,3-dihydroisoindol-5-yl)-N-[4-[(3Z)-3-hydrazinylideneprop-1-en-2-yl]phenyl]pyrimidin-4-amine.
| Compound Name | 2-(2-ethylsulfonyl-1,3-dihydroisoindol-5-yl)-N-[4-[(3Z)-3-hydrazinylideneprop-1-en-2-yl]phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 139475057 |
| Molecular Formula | C23H24N6O2S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 2-(2-ethylsulfonyl-1,3-dihydroisoindol-5-yl)-N-[4-[(3Z)-3-hydrazinylideneprop-1-en-2-yl]phenyl]pyrimidin-4-amine |
| SMILES | C=C(/C=N\N)c1ccc(Nc2ccnc(-c3ccc4c(c3)CN(S(=O)(=O)CC)C4)n2)cc1 |
| InChI | InChI=1S/C23H24N6O2S/c1-3-32(30,31)29-14-19-5-4-18(12-20(19)15-29)23-25-11-10-22(28-23)27-21-8-6-17(7-9-21)16(2)13-26-24/h4-13H,2-3,14-15,24H2,1H3,(H,25,27,28)/b26-13- |
| InChIKey | NVVWAWZIXSHCDO-ZMFRSBBQSA-N |
| XLogP | 3.51 |
| TPSA | 113.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|