C25H27N3O4 — CID 139475652
tert-butyl 2-[(4Z)-2-benzoyl-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxoimidazol-1-yl]acetate (PubChem CID 139475652) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is tert-butyl 2-[(4Z)-2-benzoyl-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxoimidazol-1-yl]acetate.
| Compound Name | tert-butyl 2-[(4Z)-2-benzoyl-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxoimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 139475652 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | tert-butyl 2-[(4Z)-2-benzoyl-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxoimidazol-1-yl]acetate |
| SMILES | CN(C)c1ccc(/C=C2\N=C(C(=O)c3ccccc3)N(CC(=O)OC(C)(C)C)C2=O)cc1 |
| InChI | InChI=1S/C25H27N3O4/c1-25(2,3)32-21(29)16-28-23(22(30)18-9-7-6-8-10-18)26-20(24(28)31)15-17-11-13-19(14-12-17)27(4)5/h6-15H,16H2,1-5H3/b20-15- |
| InChIKey | LFCNOGMAWWVHKH-HKWRFOASSA-N |
| XLogP | 3.56 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|