C26H31N3O3 — CID 139475609
tert-butyl 2-[(4Z)-2-[(E)-2-cyclohexa-1,5-dien-1-ylethenyl]-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxoimidazol-1-yl]acetate (PubChem CID 139475609) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is tert-butyl 2-[(4Z)-2-[(E)-2-cyclohexa-1,5-dien-1-ylethenyl]-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxoimidazol-1-yl]acetate.
| Compound Name | tert-butyl 2-[(4Z)-2-[(E)-2-cyclohexa-1,5-dien-1-ylethenyl]-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxoimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 139475609 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | tert-butyl 2-[(4Z)-2-[(E)-2-cyclohexa-1,5-dien-1-ylethenyl]-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxoimidazol-1-yl]acetate |
| SMILES | CN(C)c1ccc(/C=C2\N=C(/C=C/C3=CCCC=C3)N(CC(=O)OC(C)(C)C)C2=O)cc1 |
| InChI | InChI=1S/C26H31N3O3/c1-26(2,3)32-24(30)18-29-23(16-13-19-9-7-6-8-10-19)27-22(25(29)31)17-20-11-14-21(15-12-20)28(4)5/h7,9-17H,6,8,18H2,1-5H3/b16-13+,22-17- |
| InChIKey | QEUJZKVEGIKKDE-NSJYKWEZSA-N |
| XLogP | 4.51 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|