C15H21N3O — CID 139476336
(2E,4E)-5-amino-N-[(2E,4E)-5-aminohepta-2,4,6-trien-2-yl]-2-ethenylhexa-2,4-dienamide (PubChem CID 139476336) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is (2E,4E)-5-amino-N-[(2E,4E)-5-aminohepta-2,4,6-trien-2-yl]-2-ethenylhexa-2,4-dienamide.
| Compound Name | (2E,4E)-5-amino-N-[(2E,4E)-5-aminohepta-2,4,6-trien-2-yl]-2-ethenylhexa-2,4-dienamide |
|---|---|
| PubChem CID | 139476336 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | (2E,4E)-5-amino-N-[(2E,4E)-5-aminohepta-2,4,6-trien-2-yl]-2-ethenylhexa-2,4-dienamide |
| SMILES | C=C/C(N)=C\C=C(/C)NC(=O)/C(C=C)=C/C=C(\C)N |
| InChI | InChI=1S/C15H21N3O/c1-5-13(9-7-11(3)16)15(19)18-12(4)8-10-14(17)6-2/h5-10H,1-2,16-17H2,3-4H3,(H,18,19)/b11-7+,12-8+,13-9+,14-10+ |
| InChIKey | XVAJNXJXNILFCK-DQVHGGFXSA-N |
| XLogP | 2.01 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|