C15H18FN3O — CID 145084850
(2Z,5Z)-7-amino-N-[(3Z)-5-aminohexa-1,3,5-trien-2-yl]-2-fluoro-4-methylideneocta-2,5,7-trienamide (PubChem CID 145084850) has the molecular formula C15H18FN3O and a molecular weight of 275.33 g/mol. Its IUPAC name is (2Z,5Z)-7-amino-N-[(3Z)-5-aminohexa-1,3,5-trien-2-yl]-2-fluoro-4-methylideneocta-2,5,7-trienamide.
| Compound Name | (2Z,5Z)-7-amino-N-[(3Z)-5-aminohexa-1,3,5-trien-2-yl]-2-fluoro-4-methylideneocta-2,5,7-trienamide |
|---|---|
| PubChem CID | 145084850 |
| Molecular Formula | C15H18FN3O |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | (2Z,5Z)-7-amino-N-[(3Z)-5-aminohexa-1,3,5-trien-2-yl]-2-fluoro-4-methylideneocta-2,5,7-trienamide |
| SMILES | C=C(N)/C=C\C(=C)/C=C(\F)C(=O)NC(=C)/C=C\C(=C)N |
| InChI | InChI=1S/C15H18FN3O/c1-10(5-6-11(2)17)9-14(16)15(20)19-13(4)8-7-12(3)18/h5-9H,1-4,17-18H2,(H,19,20)/b6-5-,8-7-,14-9- |
| InChIKey | PIQVLZFLIGSYMU-NROSIVHLSA-N |
| XLogP | 2.08 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|