C12H20F3NO — CID 142113177
ethane;N-[(2E,4E)-1,1,1-trifluoro-2-methylhepta-2,4-dien-4-yl]acetamide (PubChem CID 142113177) has the molecular formula C12H20F3NO and a molecular weight of 251.29 g/mol. Its IUPAC name is ethane;N-[(2E,4E)-1,1,1-trifluoro-2-methylhepta-2,4-dien-4-yl]acetamide.
| Compound Name | ethane;N-[(2E,4E)-1,1,1-trifluoro-2-methylhepta-2,4-dien-4-yl]acetamide |
|---|---|
| PubChem CID | 142113177 |
| Molecular Formula | C12H20F3NO |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | ethane;N-[(2E,4E)-1,1,1-trifluoro-2-methylhepta-2,4-dien-4-yl]acetamide |
| SMILES | CC.CC/C=C(\C=C(/C)C(F)(F)F)NC(C)=O |
| InChI | InChI=1S/C10H14F3NO.C2H6/c1-4-5-9(14-8(3)15)6-7(2)10(11,12)13;1-2/h5-6H,4H2,1-3H3,(H,14,15);1-2H3/b7-6+,9-5+; |
| InChIKey | INLZQOIRQLMPOG-QGKLDBNSSA-N |
| XLogP | 3.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|