C13H20F3NO — CID 144610104
N-[(3E)-2,6-dimethylhepta-1,3,5-trien-4-yl]-2,2,2-trifluoroacetamide;ethane (PubChem CID 144610104) has the molecular formula C13H20F3NO and a molecular weight of 263.30 g/mol. Its IUPAC name is N-[(3E)-2,6-dimethylhepta-1,3,5-trien-4-yl]-2,2,2-trifluoroacetamide;ethane.
| Compound Name | N-[(3E)-2,6-dimethylhepta-1,3,5-trien-4-yl]-2,2,2-trifluoroacetamide;ethane |
|---|---|
| PubChem CID | 144610104 |
| Molecular Formula | C13H20F3NO |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | N-[(3E)-2,6-dimethylhepta-1,3,5-trien-4-yl]-2,2,2-trifluoroacetamide;ethane |
| SMILES | C=C(C)/C=C(\C=C(C)C)NC(=O)C(F)(F)F.CC |
| InChI | InChI=1S/C11H14F3NO.C2H6/c1-7(2)5-9(6-8(3)4)15-10(16)11(12,13)14;1-2/h5-6H,1H2,2-4H3,(H,15,16);1-2H3/b9-5+; |
| InChIKey | FUOKHOCFFRYPAN-SZKNIZGXSA-N |
| XLogP | 4.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|