C17H19FN2O2 — CID 142940554
7-[[(Z,2Z)-2-(1-fluoroprop-2-enylidene)hex-3-enoyl]amino]cyclohepta-1,4,6-triene-1-carboxamide (PubChem CID 142940554) has the molecular formula C17H19FN2O2 and a molecular weight of 302.35 g/mol. Its IUPAC name is 7-[[(Z,2Z)-2-(1-fluoroprop-2-enylidene)hex-3-enoyl]amino]cyclohepta-1,4,6-triene-1-carboxamide.
| Compound Name | 7-[[(Z,2Z)-2-(1-fluoroprop-2-enylidene)hex-3-enoyl]amino]cyclohepta-1,4,6-triene-1-carboxamide |
|---|---|
| PubChem CID | 142940554 |
| Molecular Formula | C17H19FN2O2 |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 7-[[(Z,2Z)-2-(1-fluoroprop-2-enylidene)hex-3-enoyl]amino]cyclohepta-1,4,6-triene-1-carboxamide |
| SMILES | C=C/C(F)=C(\C=C/CC)C(=O)NC1=CC=CCC=C1C(N)=O |
| InChI | InChI=1S/C17H19FN2O2/c1-3-5-9-12(14(18)4-2)17(22)20-15-11-8-6-7-10-13(15)16(19)21/h4-6,8-11H,2-3,7H2,1H3,(H2,19,21)(H,20,22)/b9-5-,14-12- |
| InChIKey | TZEFLUABJQELOW-JMHSEQOYSA-N |
| XLogP | 2.73 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|