C28H31F3N6O6 — CID 139477192
1-butanoyloxyethyl 3-ethyl-2,6-dioxo-1-propyl-8-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]purine-7-carboxylate (PubChem CID 139477192) has the molecular formula C28H31F3N6O6 and a molecular weight of 604.59 g/mol. Its IUPAC name is 1-butanoyloxyethyl 3-ethyl-2,6-dioxo-1-propyl-8-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]purine-7-carboxylate.
| Compound Name | 1-butanoyloxyethyl 3-ethyl-2,6-dioxo-1-propyl-8-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]purine-7-carboxylate |
|---|---|
| PubChem CID | 139477192 |
| Molecular Formula | C28H31F3N6O6 |
| Molecular Weight | 604.59 g/mol |
| Exact Mass | 604.23 |
| IUPAC Name | 1-butanoyloxyethyl 3-ethyl-2,6-dioxo-1-propyl-8-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]purine-7-carboxylate |
| SMILES | CCCC(=O)OC(C)OC(=O)n1c(-c2cnn(Cc3cccc(C(F)(F)F)c3)c2)nc2c1c(=O)n(CCC)c(=O)n2CC |
| InChI | InChI=1S/C28H31F3N6O6/c1-5-9-21(38)42-17(4)43-27(41)37-22-24(35(7-3)26(40)36(12-6-2)25(22)39)33-23(37)19-14-32-34(16-19)15-18-10-8-11-20(13-18)28(29,30)31/h8,10-11,13-14,16-17H,5-7,9,12,15H2,1-4H3 |
| InChIKey | UMJKAVYAWRLYJZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 132.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.59 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|