C24H27F3N5O7P — CID 162782047
[1-ethyl-2,4-dioxo-3-propyl-6-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]-5H-pyrrolo[2,3-d]pyrimidin-5-yl]methoxymethyl dihydrogen phosphate (PubChem CID 162782047) has the molecular formula C24H27F3N5O7P and a molecular weight of 585.48 g/mol. Its IUPAC name is [1-ethyl-2,4-dioxo-3-propyl-6-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]-5H-pyrrolo[2,3-d]pyrimidin-5-yl]methoxymethyl dihydrogen phosphate.
| Compound Name | [1-ethyl-2,4-dioxo-3-propyl-6-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]-5H-pyrrolo[2,3-d]pyrimidin-5-yl]methoxymethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 162782047 |
| Molecular Formula | C24H27F3N5O7P |
| Molecular Weight | 585.48 g/mol |
| Exact Mass | 585.16 |
| IUPAC Name | [1-ethyl-2,4-dioxo-3-propyl-6-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]-5H-pyrrolo[2,3-d]pyrimidin-5-yl]methoxymethyl dihydrogen phosphate |
| SMILES | CCCn1c(=O)c2c(n(CC)c1=O)N=C(c1cnn(Cc3cccc(C(F)(F)F)c3)c1)C2COCOP(=O)(O)O |
| InChI | InChI=1S/C24H27F3N5O7P/c1-3-8-32-22(33)19-18(13-38-14-39-40(35,36)37)20(29-21(19)31(4-2)23(32)34)16-10-28-30(12-16)11-15-6-5-7-17(9-15)24(25,26)27/h5-7,9-10,12,18H,3-4,8,11,13-14H2,1-2H3,(H2,35,36,37) |
| InChIKey | QAIZABPOURMBDL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 150.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|