About 3-methylpentan-2-yl pentan-3-yl carbonate
3-methylpentan-2-yl pentan-3-yl carbonate (PubChem CID 139479446) has the molecular formula C12H24O3
and a molecular weight of 216.32 g/mol. Its IUPAC name is 3-methylpentan-2-yl pentan-3-yl carbonate.
Molecular Properties
| Compound Name | 3-methylpentan-2-yl pentan-3-yl carbonate |
| PubChem CID | 139479446 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | 3-methylpentan-2-yl pentan-3-yl carbonate |
| SMILES | CCC(CC)OC(=O)OC(C)C(C)CC |
| InChI | InChI=1S/C12H24O3/c1-6-9(4)10(5)14-12(13)15-11(7-2)8-3/h9-11H,6-8H2,1-5H3 |
| InChIKey | WLQDXZLDKAPBKZ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methylpentan-2-yl pentan-3-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpentan-2-yl pentan-3-yl carbonate?
The IUPAC name of 3-methylpentan-2-yl pentan-3-yl carbonate (CID 139479446) is 3-methylpentan-2-yl pentan-3-yl carbonate.
What is the SMILES notation for 3-methylpentan-2-yl pentan-3-yl carbonate?
The canonical SMILES for 3-methylpentan-2-yl pentan-3-yl carbonate is CCC(CC)OC(=O)OC(C)C(C)CC.
What is the InChIKey of 3-methylpentan-2-yl pentan-3-yl carbonate?
The InChIKey is WLQDXZLDKAPBKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O3/c1-6-9(4)10(5)14-12(13)15-11(7-2)8-3/h9-11H,6-8H2,1-5H3.
What are the key properties of 3-methylpentan-2-yl pentan-3-yl carbonate?
3-methylpentan-2-yl pentan-3-yl carbonate has a molecular weight of 216.32 g/mol, XLogP of 3.76, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpentan-2-yl pentan-3-yl carbonate is sourced from PubChem (CID 139479446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).