About 1-bromoethyl pentan-3-yl carbonate
1-bromoethyl pentan-3-yl carbonate (PubChem CID 54044128) has the molecular formula C8H15BrO3
and a molecular weight of 239.11 g/mol. Its IUPAC name is 1-bromoethyl pentan-3-yl carbonate.
Molecular Properties
| Compound Name | 1-bromoethyl pentan-3-yl carbonate |
| PubChem CID | 54044128 |
| Molecular Formula | C8H15BrO3 |
| Molecular Weight | 239.11 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 1-bromoethyl pentan-3-yl carbonate |
| SMILES | CCC(CC)OC(=O)OC(C)Br |
| InChI | InChI=1S/C8H15BrO3/c1-4-7(5-2)12-8(10)11-6(3)9/h6-7H,4-5H2,1-3H3 |
| InChIKey | LOIYPGAOJIJLIG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.11 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromoethyl pentan-3-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromoethyl pentan-3-yl carbonate?
The IUPAC name of 1-bromoethyl pentan-3-yl carbonate (CID 54044128) is 1-bromoethyl pentan-3-yl carbonate.
What is the SMILES notation for 1-bromoethyl pentan-3-yl carbonate?
The canonical SMILES for 1-bromoethyl pentan-3-yl carbonate is CCC(CC)OC(=O)OC(C)Br.
What is the InChIKey of 1-bromoethyl pentan-3-yl carbonate?
The InChIKey is LOIYPGAOJIJLIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15BrO3/c1-4-7(5-2)12-8(10)11-6(3)9/h6-7H,4-5H2,1-3H3.
What are the key properties of 1-bromoethyl pentan-3-yl carbonate?
1-bromoethyl pentan-3-yl carbonate has a molecular weight of 239.11 g/mol, XLogP of 3.07, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromoethyl pentan-3-yl carbonate is sourced from PubChem (CID 54044128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).