C16H27NO3S2 — CID 139481926
tert-butyl 3-[3,3-bis(methylsulfanyl)prop-2-enoyl]-4-methylpiperidine-1-carboxylate (PubChem CID 139481926) has the molecular formula C16H27NO3S2 and a molecular weight of 345.53 g/mol. Its IUPAC name is tert-butyl 3-[3,3-bis(methylsulfanyl)prop-2-enoyl]-4-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3,3-bis(methylsulfanyl)prop-2-enoyl]-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 139481926 |
| Molecular Formula | C16H27NO3S2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | tert-butyl 3-[3,3-bis(methylsulfanyl)prop-2-enoyl]-4-methylpiperidine-1-carboxylate |
| SMILES | CSC(=CC(=O)C1CN(C(=O)OC(C)(C)C)CCC1C)SC |
| InChI | InChI=1S/C16H27NO3S2/c1-11-7-8-17(15(19)20-16(2,3)4)10-12(11)13(18)9-14(21-5)22-6/h9,11-12H,7-8,10H2,1-6H3 |
| InChIKey | PXZWYBWOYAQJAS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|