C20H17F4N5O — CID 139482036
[(1S,2S,5S)-2-[5-(difluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-8-azabicyclo[3.2.1]octan-8-yl]-(3,4-difluorophenyl)methanone (PubChem CID 139482036) has the molecular formula C20H17F4N5O and a molecular weight of 419.38 g/mol. Its IUPAC name is [(1S,2S,5S)-2-[5-(difluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-8-azabicyclo[3.2.1]octan-8-yl]-(3,4-difluorophenyl)methanone.
| Compound Name | [(1S,2S,5S)-2-[5-(difluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-8-azabicyclo[3.2.1]octan-8-yl]-(3,4-difluorophenyl)methanone |
|---|---|
| PubChem CID | 139482036 |
| Molecular Formula | C20H17F4N5O |
| Molecular Weight | 419.38 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | [(1S,2S,5S)-2-[5-(difluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-8-azabicyclo[3.2.1]octan-8-yl]-(3,4-difluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)c(F)c1)N1[C@H]2CC[C@H](c3cc(C(F)F)nc4ncnn34)[C@@H]1CC2 |
| InChI | InChI=1S/C20H17F4N5O/c21-13-5-1-10(7-14(13)22)19(30)28-11-2-4-12(16(28)6-3-11)17-8-15(18(23)24)27-20-25-9-26-29(17)20/h1,5,7-9,11-12,16,18H,2-4,6H2/t11-,12-,16-/m0/s1 |
| InChIKey | PEUOTUNBEUIMCU-MKBNYLNASA-N |
| XLogP | 3.89 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |