About [5-bromo-2-chloro-4-(4-chlorobenzoyl)phenyl] N-tert-butylcarbamate
[5-bromo-2-chloro-4-(4-chlorobenzoyl)phenyl] N-tert-butylcarbamate (PubChem CID 139484786) has the molecular formula C18H16BrCl2NO3
and a molecular weight of 445.14 g/mol. Its IUPAC name is [5-bromo-2-chloro-4-(4-chlorobenzoyl)phenyl] N-tert-butylcarbamate.
Molecular Properties
| Compound Name | [5-bromo-2-chloro-4-(4-chlorobenzoyl)phenyl] N-tert-butylcarbamate |
| PubChem CID | 139484786 |
| Molecular Formula | C18H16BrCl2NO3 |
| Molecular Weight | 445.14 g/mol |
| Exact Mass | 442.97 |
| IUPAC Name | [5-bromo-2-chloro-4-(4-chlorobenzoyl)phenyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)Oc1cc(Br)c(C(=O)c2ccc(Cl)cc2)cc1Cl |
| InChI | InChI=1S/C18H16BrCl2NO3/c1-18(2,3)22-17(24)25-15-9-13(19)12(8-14(15)21)16(23)10-4-6-11(20)7-5-10/h4-9H,1-3H3,(H,22,24) |
| InChIKey | GUPGDCWTFOTGJP-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.14 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-bromo-2-chloro-4-(4-chlorobenzoyl)phenyl] N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-bromo-2-chloro-4-(4-chlorobenzoyl)phenyl] N-tert-butylcarbamate?
The IUPAC name of [5-bromo-2-chloro-4-(4-chlorobenzoyl)phenyl] N-tert-butylcarbamate (CID 139484786) is [5-bromo-2-chloro-4-(4-chlorobenzoyl)phenyl] N-tert-butylcarbamate.
What is the SMILES notation for [5-bromo-2-chloro-4-(4-chlorobenzoyl)phenyl] N-tert-butylcarbamate?
The canonical SMILES for [5-bromo-2-chloro-4-(4-chlorobenzoyl)phenyl] N-tert-butylcarbamate is CC(C)(C)NC(=O)Oc1cc(Br)c(C(=O)c2ccc(Cl)cc2)cc1Cl.
What is the InChIKey of [5-bromo-2-chloro-4-(4-chlorobenzoyl)phenyl] N-tert-butylcarbamate?
The InChIKey is GUPGDCWTFOTGJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16BrCl2NO3/c1-18(2,3)22-17(24)25-15-9-13(19)12(8-14(15)21)16(23)10-4-6-11(20)7-5-10/h4-9H,1-3H3,(H,22,24).
What are the key properties of [5-bromo-2-chloro-4-(4-chlorobenzoyl)phenyl] N-tert-butylcarbamate?
[5-bromo-2-chloro-4-(4-chlorobenzoyl)phenyl] N-tert-butylcarbamate has a molecular weight of 445.14 g/mol, XLogP of 5.87, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-bromo-2-chloro-4-(4-chlorobenzoyl)phenyl] N-tert-butylcarbamate is sourced from PubChem (CID 139484786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).