C19H19ClN6O4S — CID 139485081
4-N-(3-aminopropyl)-5-chloro-2-N-[4-(4-nitrophenyl)sulfonylphenyl]pyrimidine-2,4-diamine (PubChem CID 139485081) has the molecular formula C19H19ClN6O4S and a molecular weight of 462.92 g/mol. Its IUPAC name is 4-N-(3-aminopropyl)-5-chloro-2-N-[4-(4-nitrophenyl)sulfonylphenyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-aminopropyl)-5-chloro-2-N-[4-(4-nitrophenyl)sulfonylphenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 139485081 |
| Molecular Formula | C19H19ClN6O4S |
| Molecular Weight | 462.92 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 4-N-(3-aminopropyl)-5-chloro-2-N-[4-(4-nitrophenyl)sulfonylphenyl]pyrimidine-2,4-diamine |
| SMILES | NCCCNc1nc(Nc2ccc(S(=O)(=O)c3ccc([N+](=O)[O-])cc3)cc2)ncc1Cl |
| InChI | InChI=1S/C19H19ClN6O4S/c20-17-12-23-19(25-18(17)22-11-1-10-21)24-13-2-6-15(7-3-13)31(29,30)16-8-4-14(5-9-16)26(27)28/h2-9,12H,1,10-11,21H2,(H2,22,23,24,25) |
| InChIKey | GOYAADNAKVCRJS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 153.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.92 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|