C23H17F3N4O4 — CID 139485281
[[2-[6-(1-phenylethylamino)-3-pyridinyl]-1,3-benzoxazole-5-carbonyl]amino] 2,2,2-trifluoroacetate (PubChem CID 139485281) has the molecular formula C23H17F3N4O4 and a molecular weight of 470.41 g/mol. Its IUPAC name is [[2-[6-(1-phenylethylamino)-3-pyridinyl]-1,3-benzoxazole-5-carbonyl]amino] 2,2,2-trifluoroacetate.
| Compound Name | [[2-[6-(1-phenylethylamino)-3-pyridinyl]-1,3-benzoxazole-5-carbonyl]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 139485281 |
| Molecular Formula | C23H17F3N4O4 |
| Molecular Weight | 470.41 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | [[2-[6-(1-phenylethylamino)-3-pyridinyl]-1,3-benzoxazole-5-carbonyl]amino] 2,2,2-trifluoroacetate |
| SMILES | CC(Nc1ccc(-c2nc3cc(C(=O)NOC(=O)C(F)(F)F)ccc3o2)cn1)c1ccccc1 |
| InChI | InChI=1S/C23H17F3N4O4/c1-13(14-5-3-2-4-6-14)28-19-10-8-16(12-27-19)21-29-17-11-15(7-9-18(17)33-21)20(31)30-34-22(32)23(24,25)26/h2-13H,1H3,(H,27,28)(H,30,31) |
| InChIKey | NROHIUFGKZBXPL-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.41 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|