C16H10F3N3O5 — CID 139485217
[[2-(2-methoxy-3-pyridinyl)-1,3-benzoxazole-5-carbonyl]amino] 2,2,2-trifluoroacetate (PubChem CID 139485217) has the molecular formula C16H10F3N3O5 and a molecular weight of 381.27 g/mol. Its IUPAC name is [[2-(2-methoxy-3-pyridinyl)-1,3-benzoxazole-5-carbonyl]amino] 2,2,2-trifluoroacetate.
| Compound Name | [[2-(2-methoxy-3-pyridinyl)-1,3-benzoxazole-5-carbonyl]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 139485217 |
| Molecular Formula | C16H10F3N3O5 |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | [[2-(2-methoxy-3-pyridinyl)-1,3-benzoxazole-5-carbonyl]amino] 2,2,2-trifluoroacetate |
| SMILES | COc1ncccc1-c1nc2cc(C(=O)NOC(=O)C(F)(F)F)ccc2o1 |
| InChI | InChI=1S/C16H10F3N3O5/c1-25-13-9(3-2-6-20-13)14-21-10-7-8(4-5-11(10)26-14)12(23)22-27-15(24)16(17,18)19/h2-7H,1H3,(H,22,23) |
| InChIKey | PZVCGGIEFAWPIZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|