C14H15ClN2O2 — CID 139487362
ethyl 2-(chloromethyl)-6-cyclopropylimidazo[1,2-a]pyridine-8-carboxylate (PubChem CID 139487362) has the molecular formula C14H15ClN2O2 and a molecular weight of 278.74 g/mol. Its IUPAC name is ethyl 2-(chloromethyl)-6-cyclopropylimidazo[1,2-a]pyridine-8-carboxylate.
| Compound Name | ethyl 2-(chloromethyl)-6-cyclopropylimidazo[1,2-a]pyridine-8-carboxylate |
|---|---|
| PubChem CID | 139487362 |
| Molecular Formula | C14H15ClN2O2 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | ethyl 2-(chloromethyl)-6-cyclopropylimidazo[1,2-a]pyridine-8-carboxylate |
| SMILES | CCOC(=O)c1cc(C2CC2)cn2cc(CCl)nc12 |
| InChI | InChI=1S/C14H15ClN2O2/c1-2-19-14(18)12-5-10(9-3-4-9)7-17-8-11(6-15)16-13(12)17/h5,7-9H,2-4,6H2,1H3 |
| InChIKey | XWNVBDHKNHXAAV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|