C11H10ClFN2 — CID 139487322
2-(chloromethyl)-6-cyclopropyl-8-fluoroimidazo[1,2-a]pyridine (PubChem CID 139487322) has the molecular formula C11H10ClFN2 and a molecular weight of 224.67 g/mol. Its IUPAC name is 2-(chloromethyl)-6-cyclopropyl-8-fluoroimidazo[1,2-a]pyridine.
| Compound Name | 2-(chloromethyl)-6-cyclopropyl-8-fluoroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 139487322 |
| Molecular Formula | C11H10ClFN2 |
| Molecular Weight | 224.67 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 2-(chloromethyl)-6-cyclopropyl-8-fluoroimidazo[1,2-a]pyridine |
| SMILES | Fc1cc(C2CC2)cn2cc(CCl)nc12 |
| InChI | InChI=1S/C11H10ClFN2/c12-4-9-6-15-5-8(7-1-2-7)3-10(13)11(15)14-9/h3,5-7H,1-2,4H2 |
| InChIKey | VUMNTVXFLFAUTB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.67 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|