C12H10ClN3 — CID 139487891
2-(chloromethyl)-6-cyclopropylimidazo[1,2-a]pyridine-8-carbonitrile (PubChem CID 139487891) has the molecular formula C12H10ClN3 and a molecular weight of 231.69 g/mol. Its IUPAC name is 2-(chloromethyl)-6-cyclopropylimidazo[1,2-a]pyridine-8-carbonitrile.
| Compound Name | 2-(chloromethyl)-6-cyclopropylimidazo[1,2-a]pyridine-8-carbonitrile |
|---|---|
| PubChem CID | 139487891 |
| Molecular Formula | C12H10ClN3 |
| Molecular Weight | 231.69 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 2-(chloromethyl)-6-cyclopropylimidazo[1,2-a]pyridine-8-carbonitrile |
| SMILES | N#Cc1cc(C2CC2)cn2cc(CCl)nc12 |
| InChI | InChI=1S/C12H10ClN3/c13-4-11-7-16-6-10(8-1-2-8)3-9(5-14)12(16)15-11/h3,6-8H,1-2,4H2 |
| InChIKey | GRQVCUCESKLKLO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 41.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.69 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|