C21H27N3O5 — CID 139491696
8-(3-methoxypropoxy)-9-(methylamino)-2-oxo-5-propan-2-yl-5,6-dihydro-1H-1,10-phenanthroline-3-carboxylic acid (PubChem CID 139491696) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is 8-(3-methoxypropoxy)-9-(methylamino)-2-oxo-5-propan-2-yl-5,6-dihydro-1H-1,10-phenanthroline-3-carboxylic acid.
| Compound Name | 8-(3-methoxypropoxy)-9-(methylamino)-2-oxo-5-propan-2-yl-5,6-dihydro-1H-1,10-phenanthroline-3-carboxylic acid |
|---|---|
| PubChem CID | 139491696 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 8-(3-methoxypropoxy)-9-(methylamino)-2-oxo-5-propan-2-yl-5,6-dihydro-1H-1,10-phenanthroline-3-carboxylic acid |
| SMILES | CNc1nc2c(cc1OCCCOC)CC(C(C)C)c1cc(C(=O)O)c(=O)[nH]c1-2 |
| InChI | InChI=1S/C21H27N3O5/c1-11(2)13-8-12-9-16(29-7-5-6-28-4)19(22-3)23-17(12)18-14(13)10-15(21(26)27)20(25)24-18/h9-11,13H,5-8H2,1-4H3,(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | PYAKTHQOGKZKIU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|