C20H23ClN2O4 — CID 162123340
8-butoxy-9-chloro-2-oxo-5-propan-2-yl-5,6-dihydro-1H-1,10-phenanthroline-3-carboxylic acid (PubChem CID 162123340) has the molecular formula C20H23ClN2O4 and a molecular weight of 390.87 g/mol. Its IUPAC name is 8-butoxy-9-chloro-2-oxo-5-propan-2-yl-5,6-dihydro-1H-1,10-phenanthroline-3-carboxylic acid.
| Compound Name | 8-butoxy-9-chloro-2-oxo-5-propan-2-yl-5,6-dihydro-1H-1,10-phenanthroline-3-carboxylic acid |
|---|---|
| PubChem CID | 162123340 |
| Molecular Formula | C20H23ClN2O4 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 8-butoxy-9-chloro-2-oxo-5-propan-2-yl-5,6-dihydro-1H-1,10-phenanthroline-3-carboxylic acid |
| SMILES | CCCCOc1cc2c(nc1Cl)-c1[nH]c(=O)c(C(=O)O)cc1C(C(C)C)C2 |
| InChI | InChI=1S/C20H23ClN2O4/c1-4-5-6-27-15-8-11-7-12(10(2)3)13-9-14(20(25)26)19(24)23-17(13)16(11)22-18(15)21/h8-10,12H,4-7H2,1-3H3,(H,23,24)(H,25,26) |
| InChIKey | ZHRWPJZVWSNZMD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|