C8H14N2 — CID 139491920
3-[(1Z)-buta-1,3-dienyl]iminobutan-1-amine (PubChem CID 139491920) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]iminobutan-1-amine.
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]iminobutan-1-amine |
|---|---|
| PubChem CID | 139491920 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]iminobutan-1-amine |
| SMILES | C=C/C=C\N=C(/C)CCN |
| InChI | InChI=1S/C8H14N2/c1-3-4-7-10-8(2)5-6-9/h3-4,7H,1,5-6,9H2,2H3/b7-4-,10-8+ |
| InChIKey | VUJWMLFWYVRPAO-WIXOJMCHSA-N |
| XLogP | 1.50 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|