C28H26ClFN4O2 — CID 139491999
[2-[[2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(5-fluoro-2-methoxyphenyl)methanone (PubChem CID 139491999) has the molecular formula C28H26ClFN4O2 and a molecular weight of 504.99 g/mol. Its IUPAC name is [2-[[2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(5-fluoro-2-methoxyphenyl)methanone.
| Compound Name | [2-[[2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(5-fluoro-2-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 139491999 |
| Molecular Formula | C28H26ClFN4O2 |
| Molecular Weight | 504.99 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | [2-[[2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(5-fluoro-2-methoxyphenyl)methanone |
| SMILES | COc1ccc(F)cc1C(=O)N1CC2CN(Cc3c(-c4ccc(Cl)cc4)nc4ccccn34)CC2C1 |
| InChI | InChI=1S/C28H26ClFN4O2/c1-36-25-10-9-22(30)12-23(25)28(35)33-15-19-13-32(14-20(19)16-33)17-24-27(18-5-7-21(29)8-6-18)31-26-4-2-3-11-34(24)26/h2-12,19-20H,13-17H2,1H3 |
| InChIKey | NMVDNZPTQCCLBJ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.99 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |