About 1,5-dimethyl-N-(2-methylpropyl)-1,2,4-triazol-3-amine
1,5-dimethyl-N-(2-methylpropyl)-1,2,4-triazol-3-amine (PubChem CID 139492479) has the molecular formula C8H16N4
and a molecular weight of 168.24 g/mol. Its IUPAC name is 1,5-dimethyl-N-(2-methylpropyl)-1,2,4-triazol-3-amine.
Analyze 1,5-dimethyl-N-(2-methylpropyl)-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-N-(2-methylpropyl)-1,2,4-triazol-3-amine?
The IUPAC name of 1,5-dimethyl-N-(2-methylpropyl)-1,2,4-triazol-3-amine (CID 139492479) is 1,5-dimethyl-N-(2-methylpropyl)-1,2,4-triazol-3-amine.
What is the SMILES notation for 1,5-dimethyl-N-(2-methylpropyl)-1,2,4-triazol-3-amine?
The canonical SMILES for 1,5-dimethyl-N-(2-methylpropyl)-1,2,4-triazol-3-amine is Cc1nc(NCC(C)C)nn1C.
What is the InChIKey of 1,5-dimethyl-N-(2-methylpropyl)-1,2,4-triazol-3-amine?
The InChIKey is AGTVGFCHJWVBHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4/c1-6(2)5-9-8-10-7(3)12(4)11-8/h6H,5H2,1-4H3,(H,9,11).
What are the key properties of 1,5-dimethyl-N-(2-methylpropyl)-1,2,4-triazol-3-amine?
1,5-dimethyl-N-(2-methylpropyl)-1,2,4-triazol-3-amine has a molecular weight of 168.24 g/mol, XLogP of 1.19, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-N-(2-methylpropyl)-1,2,4-triazol-3-amine is sourced from PubChem (CID 139492479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).