C19H35N — CID 139493100
(E)-4-butyl-N,4-dimethyl-3-[(Z)-prop-1-enyl]dec-2-en-1-imine (PubChem CID 139493100) has the molecular formula C19H35N and a molecular weight of 277.50 g/mol. Its IUPAC name is (E)-4-butyl-N,4-dimethyl-3-[(Z)-prop-1-enyl]dec-2-en-1-imine.
| Compound Name | (E)-4-butyl-N,4-dimethyl-3-[(Z)-prop-1-enyl]dec-2-en-1-imine |
|---|---|
| PubChem CID | 139493100 |
| Molecular Formula | C19H35N |
| Molecular Weight | 277.50 g/mol |
| Exact Mass | 277.28 |
| IUPAC Name | (E)-4-butyl-N,4-dimethyl-3-[(Z)-prop-1-enyl]dec-2-en-1-imine |
| SMILES | C/C=C\C(=C/C=N/C)C(C)(CCCC)CCCCCC |
| InChI | InChI=1S/C19H35N/c1-6-9-11-12-16-19(4,15-10-7-2)18(13-8-3)14-17-20-5/h8,13-14,17H,6-7,9-12,15-16H2,1-5H3/b13-8-,18-14+,20-17+ |
| InChIKey | UAJDAQPPQTVNSH-GLIWYTDVSA-N |
| XLogP | 6.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.50 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|