C11H18N4S — CID 139494686
2-amino-3-tert-butyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-4-thione (PubChem CID 139494686) has the molecular formula C11H18N4S and a molecular weight of 238.36 g/mol. Its IUPAC name is 2-amino-3-tert-butyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-4-thione.
| Compound Name | 2-amino-3-tert-butyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 139494686 |
| Molecular Formula | C11H18N4S |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 2-amino-3-tert-butyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-4-thione |
| SMILES | CC(C)(C)n1c(N)nc2c(c1=S)CCNC2 |
| InChI | InChI=1S/C11H18N4S/c1-11(2,3)15-9(16)7-4-5-13-6-8(7)14-10(15)12/h13H,4-6H2,1-3H3,(H2,12,14) |
| InChIKey | AFISEMKBAUZGHF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|