C16H10ClN — CID 139496406
5-chlorobenzo[b]carbazole (PubChem CID 139496406) has the molecular formula C16H10ClN and a molecular weight of 251.72 g/mol. Its IUPAC name is 5-chlorobenzo[b]carbazole.
| Compound Name | 5-chlorobenzo[b]carbazole |
|---|---|
| PubChem CID | 139496406 |
| Molecular Formula | C16H10ClN |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 5-chlorobenzo[b]carbazole |
| SMILES | Cln1c2ccccc2c2cc3ccccc3cc21 |
| InChI | InChI=1S/C16H10ClN/c17-18-15-8-4-3-7-13(15)14-9-11-5-1-2-6-12(11)10-16(14)18/h1-10H |
| InChIKey | OVEZTVOUNUGQOZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |