C34H41N5O10 — CID 139496447
[(2R,3R,4R,5S)-2,3,4-triacetyloxy-6-[[6-[[bis(pyridin-2-ylmethyl)amino]methyl]pyridine-3-carbonyl]-methylamino]-5-hydroxyhexyl] acetate (PubChem CID 139496447) has the molecular formula C34H41N5O10 and a molecular weight of 679.73 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-2,3,4-triacetyloxy-6-[[6-[[bis(pyridin-2-ylmethyl)amino]methyl]pyridine-3-carbonyl]-methylamino]-5-hydroxyhexyl] acetate.
| Compound Name | [(2R,3R,4R,5S)-2,3,4-triacetyloxy-6-[[6-[[bis(pyridin-2-ylmethyl)amino]methyl]pyridine-3-carbonyl]-methylamino]-5-hydroxyhexyl] acetate |
|---|---|
| PubChem CID | 139496447 |
| Molecular Formula | C34H41N5O10 |
| Molecular Weight | 679.73 g/mol |
| Exact Mass | 679.29 |
| IUPAC Name | [(2R,3R,4R,5S)-2,3,4-triacetyloxy-6-[[6-[[bis(pyridin-2-ylmethyl)amino]methyl]pyridine-3-carbonyl]-methylamino]-5-hydroxyhexyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](O)CN(C)C(=O)c1ccc(CN(Cc2ccccn2)Cc2ccccn2)nc1 |
| InChI | InChI=1S/C34H41N5O10/c1-22(40)46-21-31(47-23(2)41)33(49-25(4)43)32(48-24(3)42)30(44)20-38(5)34(45)26-12-13-29(37-16-26)19-39(17-27-10-6-8-14-35-27)18-28-11-7-9-15-36-28/h6-16,30-33,44H,17-21H2,1-5H3/t30-,31+,32+,33+/m0/s1 |
| InChIKey | AIERIRJBDHEWGH-LDLFXXLYSA-N |
| XLogP | 1.87 |
| TPSA | 187.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.73 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|