C34H40N6O7 — CID 134274836
6-[[bis(pyridin-2-ylmethyl)amino]methyl]-N-[4-[2-[methyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]-2-oxoethyl]phenyl]pyridine-3-carboxamide (PubChem CID 134274836) has the molecular formula C34H40N6O7 and a molecular weight of 644.73 g/mol. Its IUPAC name is 6-[[bis(pyridin-2-ylmethyl)amino]methyl]-N-[4-[2-[methyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]-2-oxoethyl]phenyl]pyridine-3-carboxamide.
| Compound Name | 6-[[bis(pyridin-2-ylmethyl)amino]methyl]-N-[4-[2-[methyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]-2-oxoethyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 134274836 |
| Molecular Formula | C34H40N6O7 |
| Molecular Weight | 644.73 g/mol |
| Exact Mass | 644.30 |
| IUPAC Name | 6-[[bis(pyridin-2-ylmethyl)amino]methyl]-N-[4-[2-[methyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]-2-oxoethyl]phenyl]pyridine-3-carboxamide |
| SMILES | CN(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C(=O)Cc1ccc(NC(=O)c2ccc(CN(Cc3ccccn3)Cc3ccccn3)nc2)cc1 |
| InChI | InChI=1S/C34H40N6O7/c1-39(21-29(42)32(45)33(46)30(43)22-41)31(44)16-23-8-11-25(12-9-23)38-34(47)24-10-13-28(37-17-24)20-40(18-26-6-2-4-14-35-26)19-27-7-3-5-15-36-27/h2-15,17,29-30,32-33,41-43,45-46H,16,18-22H2,1H3,(H,38,47)/t29-,30+,32+,33+/m0/s1 |
| InChIKey | HZSFXQXDCSOYDL-GITOVDKFSA-N |
| XLogP | 0.76 |
| TPSA | 192.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.73 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |