C30H44N6O6 — CID 172578851
2-[2-[bis(pyridin-2-ylmethyl)amino]ethyl-[(3Z)-2-methyliminohexa-3,5-dienyl]amino]-N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)acetamide (PubChem CID 172578851) has the molecular formula C30H44N6O6 and a molecular weight of 584.72 g/mol. Its IUPAC name is 2-[2-[bis(pyridin-2-ylmethyl)amino]ethyl-[(3Z)-2-methyliminohexa-3,5-dienyl]amino]-N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)acetamide.
| Compound Name | 2-[2-[bis(pyridin-2-ylmethyl)amino]ethyl-[(3Z)-2-methyliminohexa-3,5-dienyl]amino]-N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)acetamide |
|---|---|
| PubChem CID | 172578851 |
| Molecular Formula | C30H44N6O6 |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | 2-[2-[bis(pyridin-2-ylmethyl)amino]ethyl-[(3Z)-2-methyliminohexa-3,5-dienyl]amino]-N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)acetamide |
| SMILES | C=C/C=C\C(CN(CCN(Cc1ccccn1)Cc1ccccn1)CC(=O)N(C)CC(O)C(O)C(O)C(O)CO)=N/C |
| InChI | InChI=1S/C30H44N6O6/c1-4-5-10-23(31-2)17-36(21-28(40)34(3)20-26(38)29(41)30(42)27(39)22-37)16-15-35(18-24-11-6-8-13-32-24)19-25-12-7-9-14-33-25/h4-14,26-27,29-30,37-39,41-42H,1,15-22H2,2-3H3/b10-5-,31-23+ |
| InChIKey | GNNLMAKGJYNIMA-DXJDRJTISA-N |
| XLogP | -0.51 |
| TPSA | 166.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|