C33H38N8O3 — CID 59307246
6-[[[3-[bis(pyridin-2-ylmethyl)amino]-2-hydroxypropyl]-(pyridin-2-ylmethyl)amino]methyl]-N-[2-(prop-2-enoylamino)ethyl]pyridine-3-carboxamide (PubChem CID 59307246) has the molecular formula C33H38N8O3 and a molecular weight of 594.72 g/mol. Its IUPAC name is 6-[[[3-[bis(pyridin-2-ylmethyl)amino]-2-hydroxypropyl]-(pyridin-2-ylmethyl)amino]methyl]-N-[2-(prop-2-enoylamino)ethyl]pyridine-3-carboxamide.
| Compound Name | 6-[[[3-[bis(pyridin-2-ylmethyl)amino]-2-hydroxypropyl]-(pyridin-2-ylmethyl)amino]methyl]-N-[2-(prop-2-enoylamino)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59307246 |
| Molecular Formula | C33H38N8O3 |
| Molecular Weight | 594.72 g/mol |
| Exact Mass | 594.31 |
| IUPAC Name | 6-[[[3-[bis(pyridin-2-ylmethyl)amino]-2-hydroxypropyl]-(pyridin-2-ylmethyl)amino]methyl]-N-[2-(prop-2-enoylamino)ethyl]pyridine-3-carboxamide |
| SMILES | C=CC(=O)NCCNC(=O)c1ccc(CN(Cc2ccccn2)CC(O)CN(Cc2ccccn2)Cc2ccccn2)nc1 |
| InChI | InChI=1S/C33H38N8O3/c1-2-32(43)37-17-18-38-33(44)26-12-13-30(39-19-26)23-41(22-29-11-5-8-16-36-29)25-31(42)24-40(20-27-9-3-6-14-34-27)21-28-10-4-7-15-35-28/h2-16,19,31,42H,1,17-18,20-25H2,(H,37,43)(H,38,44) |
| InChIKey | AFHAABAUELLDNL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 136.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.72 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|