C20H24N4O — CID 102576815
6-[[hepta-1,6-dien-4-yl(pyridin-2-ylmethyl)amino]methyl]pyridine-3-carboxamide (PubChem CID 102576815) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is 6-[[hepta-1,6-dien-4-yl(pyridin-2-ylmethyl)amino]methyl]pyridine-3-carboxamide.
| Compound Name | 6-[[hepta-1,6-dien-4-yl(pyridin-2-ylmethyl)amino]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 102576815 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 6-[[hepta-1,6-dien-4-yl(pyridin-2-ylmethyl)amino]methyl]pyridine-3-carboxamide |
| SMILES | C=CCC(CC=C)N(Cc1ccccn1)Cc1ccc(C(N)=O)cn1 |
| InChI | InChI=1S/C20H24N4O/c1-3-7-19(8-4-2)24(14-17-9-5-6-12-22-17)15-18-11-10-16(13-23-18)20(21)25/h3-6,9-13,19H,1-2,7-8,14-15H2,(H2,21,25) |
| InChIKey | YFPIMRZMKASXLT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|