C49H48N8O3 — CID 155068859
2-[[[3-[bis(pyridin-2-ylmethyl)amino]-2-hydroxypropyl]-(pyridin-2-ylmethyl)amino]methyl]-N-[2-(3-pyren-1-ylpropanoylamino)ethyl]pyridine-4-carboxamide (PubChem CID 155068859) has the molecular formula C49H48N8O3 and a molecular weight of 796.98 g/mol. Its IUPAC name is 2-[[[3-[bis(pyridin-2-ylmethyl)amino]-2-hydroxypropyl]-(pyridin-2-ylmethyl)amino]methyl]-N-[2-(3-pyren-1-ylpropanoylamino)ethyl]pyridine-4-carboxamide.
| Compound Name | 2-[[[3-[bis(pyridin-2-ylmethyl)amino]-2-hydroxypropyl]-(pyridin-2-ylmethyl)amino]methyl]-N-[2-(3-pyren-1-ylpropanoylamino)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 155068859 |
| Molecular Formula | C49H48N8O3 |
| Molecular Weight | 796.98 g/mol |
| Exact Mass | 796.38 |
| IUPAC Name | 2-[[[3-[bis(pyridin-2-ylmethyl)amino]-2-hydroxypropyl]-(pyridin-2-ylmethyl)amino]methyl]-N-[2-(3-pyren-1-ylpropanoylamino)ethyl]pyridine-4-carboxamide |
| SMILES | O=C(CCc1ccc2ccc3cccc4ccc1c2c34)NCCNC(=O)c1ccnc(CN(Cc2ccccn2)CC(O)CN(Cc2ccccn2)Cc2ccccn2)c1 |
| InChI | InChI=1S/C49H48N8O3/c58-44(33-56(29-40-10-1-4-22-50-40)30-41-11-2-5-23-51-41)34-57(31-42-12-3-6-24-52-42)32-43-28-39(21-25-53-43)49(60)55-27-26-54-46(59)20-18-35-13-14-38-16-15-36-8-7-9-37-17-19-45(35)48(38)47(36)37/h1-17,19,21-25,28,44,58H,18,20,26-27,29-34H2,(H,54,59)(H,55,60) |
| InChIKey | XOKUUCVWBKEVII-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 136.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.98 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|