C40H44F5N7O5 — CID 171403393
(2,3,4,5,6-pentafluorophenyl) 4-[2-[[2-[[bis(pyridin-2-ylmethyl)amino]methyl]pyridine-4-carbonyl]amino]ethylcarbamoyl]-7-(dimethylamino)-2-ethyl-6-methyl-7-oxoheptanoate (PubChem CID 171403393) has the molecular formula C40H44F5N7O5 and a molecular weight of 797.83 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 4-[2-[[2-[[bis(pyridin-2-ylmethyl)amino]methyl]pyridine-4-carbonyl]amino]ethylcarbamoyl]-7-(dimethylamino)-2-ethyl-6-methyl-7-oxoheptanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 4-[2-[[2-[[bis(pyridin-2-ylmethyl)amino]methyl]pyridine-4-carbonyl]amino]ethylcarbamoyl]-7-(dimethylamino)-2-ethyl-6-methyl-7-oxoheptanoate |
|---|---|
| PubChem CID | 171403393 |
| Molecular Formula | C40H44F5N7O5 |
| Molecular Weight | 797.83 g/mol |
| Exact Mass | 797.33 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 4-[2-[[2-[[bis(pyridin-2-ylmethyl)amino]methyl]pyridine-4-carbonyl]amino]ethylcarbamoyl]-7-(dimethylamino)-2-ethyl-6-methyl-7-oxoheptanoate |
| SMILES | CCC(CC(CC(C)C(=O)N(C)C)C(=O)NCCNC(=O)c1ccnc(CN(Cc2ccccn2)Cc2ccccn2)c1)C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C40H44F5N7O5/c1-5-25(40(56)57-36-34(44)32(42)31(41)33(43)35(36)45)19-27(18-24(2)39(55)51(3)4)38(54)50-17-16-49-37(53)26-12-15-48-30(20-26)23-52(21-28-10-6-8-13-46-28)22-29-11-7-9-14-47-29/h6-15,20,24-25,27H,5,16-19,21-23H2,1-4H3,(H,49,53)(H,50,54) |
| InChIKey | CXEWYTXAKFAJJZ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 146.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.83 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|