C26H30N2O11S — CID 139497391
methyl 2-[1-[[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]acetyl]oxyacetyl]oxymethyl]indole-3-carbonyl]-1,3-thiazole-4-carboxylate (PubChem CID 139497391) has the molecular formula C26H30N2O11S and a molecular weight of 578.60 g/mol. Its IUPAC name is methyl 2-[1-[[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]acetyl]oxyacetyl]oxymethyl]indole-3-carbonyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[1-[[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]acetyl]oxyacetyl]oxymethyl]indole-3-carbonyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 139497391 |
| Molecular Formula | C26H30N2O11S |
| Molecular Weight | 578.60 g/mol |
| Exact Mass | 578.16 |
| IUPAC Name | methyl 2-[1-[[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]acetyl]oxyacetyl]oxymethyl]indole-3-carbonyl]-1,3-thiazole-4-carboxylate |
| SMILES | COCCOCCOCCOCC(=O)OCC(=O)OCn1cc(C(=O)c2nc(C(=O)OC)cs2)c2ccccc21 |
| InChI | InChI=1S/C26H30N2O11S/c1-33-7-8-35-9-10-36-11-12-37-14-22(29)38-15-23(30)39-17-28-13-19(18-5-3-4-6-21(18)28)24(31)25-27-20(16-40-25)26(32)34-2/h3-6,13,16H,7-12,14-15,17H2,1-2H3 |
| InChIKey | IKTHMIMVADETDN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 150.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.60 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|