C14H10N2O3S — CID 4668801
methyl 2-(1H-indole-3-carbonyl)-1,3-thiazole-4-carboxylate (PubChem CID 4668801) has the molecular formula C14H10N2O3S and a molecular weight of 286.31 g/mol. Its IUPAC name is methyl 2-(1H-indole-3-carbonyl)-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-(1H-indole-3-carbonyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 4668801 |
| Molecular Formula | C14H10N2O3S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | methyl 2-(1H-indole-3-carbonyl)-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(C(=O)c2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C14H10N2O3S/c1-19-14(18)11-7-20-13(16-11)12(17)9-6-15-10-5-3-2-4-8(9)10/h2-7,15H,1H3 |
| InChIKey | KDDXOGDIPZSCTM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |