C18H16O4S2 — CID 139498418
phenyl 3-[(3-cyclohexa-1,5-dien-3-yn-1-yloxy-3-oxopropyl)disulfanyl]propanoate (PubChem CID 139498418) has the molecular formula C18H16O4S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is phenyl 3-[(3-cyclohexa-1,5-dien-3-yn-1-yloxy-3-oxopropyl)disulfanyl]propanoate.
| Compound Name | phenyl 3-[(3-cyclohexa-1,5-dien-3-yn-1-yloxy-3-oxopropyl)disulfanyl]propanoate |
|---|---|
| PubChem CID | 139498418 |
| Molecular Formula | C18H16O4S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | phenyl 3-[(3-cyclohexa-1,5-dien-3-yn-1-yloxy-3-oxopropyl)disulfanyl]propanoate |
| SMILES | O=C(CCSSCCC(=O)Oc1ccccc1)Oc1cc#ccc1 |
| InChI | InChI=1S/C18H16O4S2/c19-17(21-15-7-3-1-4-8-15)11-13-23-24-14-12-18(20)22-16-9-5-2-6-10-16/h1,3-5,7-10H,11-14H2 |
| InChIKey | WUVRHTHFELGBQY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|