About 3-(2-carboxyethyldisulfanyl)propanoic acid;phenyl 3-[(3-oxo-3-phenoxypropyl)disulfanyl]propanoate
3-(2-carboxyethyldisulfanyl)propanoic acid;phenyl 3-[(3-oxo-3-phenoxypropyl)disulfanyl]propanoate (PubChem CID 160907469) has the molecular formula C24H28O8S4
and a molecular weight of 572.75 g/mol. Its IUPAC name is 3-(2-carboxyethyldisulfanyl)propanoic acid;phenyl 3-[(3-oxo-3-phenoxypropyl)disulfanyl]propanoate.
Molecular Properties
| Compound Name | 3-(2-carboxyethyldisulfanyl)propanoic acid;phenyl 3-[(3-oxo-3-phenoxypropyl)disulfanyl]propanoate |
| PubChem CID | 160907469 |
| Molecular Formula | C24H28O8S4 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.07 |
| IUPAC Name | 3-(2-carboxyethyldisulfanyl)propanoic acid;phenyl 3-[(3-oxo-3-phenoxypropyl)disulfanyl]propanoate |
| SMILES | O=C(CCSSCCC(=O)Oc1ccccc1)Oc1ccccc1.O=C(O)CCSSCCC(=O)O |
| InChI | InChI=1S/C18H18O4S2.C6H10O4S2/c19-17(21-15-7-3-1-4-8-15)11-13-23-24-14-12-18(20)22-16-9-5-2-6-10-16;7-5(8)1-3-11-12-4-2-6(9)10/h1-10H,11-14H2;1-4H2,(H,7,8)(H,9,10) |
| InChIKey | SQIIQANOLUNQDQ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-carboxyethyldisulfanyl)propanoic acid;phenyl 3-[(3-oxo-3-phenoxypropyl)disulfanyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-carboxyethyldisulfanyl)propanoic acid;phenyl 3-[(3-oxo-3-phenoxypropyl)disulfanyl]propanoate?
The IUPAC name of 3-(2-carboxyethyldisulfanyl)propanoic acid;phenyl 3-[(3-oxo-3-phenoxypropyl)disulfanyl]propanoate (CID 160907469) is 3-(2-carboxyethyldisulfanyl)propanoic acid;phenyl 3-[(3-oxo-3-phenoxypropyl)disulfanyl]propanoate.
What is the SMILES notation for 3-(2-carboxyethyldisulfanyl)propanoic acid;phenyl 3-[(3-oxo-3-phenoxypropyl)disulfanyl]propanoate?
The canonical SMILES for 3-(2-carboxyethyldisulfanyl)propanoic acid;phenyl 3-[(3-oxo-3-phenoxypropyl)disulfanyl]propanoate is O=C(CCSSCCC(=O)Oc1ccccc1)Oc1ccccc1.O=C(O)CCSSCCC(=O)O.
What is the InChIKey of 3-(2-carboxyethyldisulfanyl)propanoic acid;phenyl 3-[(3-oxo-3-phenoxypropyl)disulfanyl]propanoate?
The InChIKey is SQIIQANOLUNQDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O4S2.C6H10O4S2/c19-17(21-15-7-3-1-4-8-15)11-13-23-24-14-12-18(20)22-16-9-5-2-6-10-16;7-5(8)1-3-11-12-4-2-6(9)10/h1-10H,11-14H2;1-4H2,(H,7,8)(H,9,10).
What are the key properties of 3-(2-carboxyethyldisulfanyl)propanoic acid;phenyl 3-[(3-oxo-3-phenoxypropyl)disulfanyl]propanoate?
3-(2-carboxyethyldisulfanyl)propanoic acid;phenyl 3-[(3-oxo-3-phenoxypropyl)disulfanyl]propanoate has a molecular weight of 572.75 g/mol, XLogP of 5.68, 16 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-carboxyethyldisulfanyl)propanoic acid;phenyl 3-[(3-oxo-3-phenoxypropyl)disulfanyl]propanoate is sourced from PubChem (CID 160907469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).