C54H35N5 — CID 139498575
1,2-diphenyl-4-[4-[4-phenyl-6-(3-phenylphenyl)pyrimidin-2-yl]phenyl]imidazo[4,5-i]phenanthridine (PubChem CID 139498575) has the molecular formula C54H35N5 and a molecular weight of 753.91 g/mol. Its IUPAC name is 1,2-diphenyl-4-[4-[4-phenyl-6-(3-phenylphenyl)pyrimidin-2-yl]phenyl]imidazo[4,5-i]phenanthridine.
| Compound Name | 1,2-diphenyl-4-[4-[4-phenyl-6-(3-phenylphenyl)pyrimidin-2-yl]phenyl]imidazo[4,5-i]phenanthridine |
|---|---|
| PubChem CID | 139498575 |
| Molecular Formula | C54H35N5 |
| Molecular Weight | 753.91 g/mol |
| Exact Mass | 753.29 |
| IUPAC Name | 1,2-diphenyl-4-[4-[4-phenyl-6-(3-phenylphenyl)pyrimidin-2-yl]phenyl]imidazo[4,5-i]phenanthridine |
| SMILES | c1ccc(-c2cccc(-c3cc(-c4ccccc4)nc(-c4ccc(-c5nc6ccccc6c6ccc7c(nc(-c8ccccc8)n7-c7ccccc7)c56)cc4)n3)c2)cc1 |
| InChI | InChI=1S/C54H35N5/c1-5-16-36(17-6-1)41-22-15-23-42(34-41)48-35-47(37-18-7-2-8-19-37)56-53(57-48)39-30-28-38(29-31-39)51-50-45(44-26-13-14-27-46(44)55-51)32-33-49-52(50)58-54(40-20-9-3-10-21-40)59(49)43-24-11-4-12-25-43/h1-35H |
| InChIKey | NTHVDAZQEQLYKL-UHFFFAOYSA-N |
| XLogP | 13.52 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.91 |
| LogP ≤ 5 | 13.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|