C46H29N7 — CID 139499068
4-[4-(4,6-dipyridin-2-ylpyrimidin-2-yl)phenyl]-1,2-diphenylimidazo[4,5-i]phenanthridine (PubChem CID 139499068) has the molecular formula C46H29N7 and a molecular weight of 679.79 g/mol. Its IUPAC name is 4-[4-(4,6-dipyridin-2-ylpyrimidin-2-yl)phenyl]-1,2-diphenylimidazo[4,5-i]phenanthridine.
| Compound Name | 4-[4-(4,6-dipyridin-2-ylpyrimidin-2-yl)phenyl]-1,2-diphenylimidazo[4,5-i]phenanthridine |
|---|---|
| PubChem CID | 139499068 |
| Molecular Formula | C46H29N7 |
| Molecular Weight | 679.79 g/mol |
| Exact Mass | 679.25 |
| IUPAC Name | 4-[4-(4,6-dipyridin-2-ylpyrimidin-2-yl)phenyl]-1,2-diphenylimidazo[4,5-i]phenanthridine |
| SMILES | c1ccc(-c2nc3c4c(-c5ccc(-c6nc(-c7ccccn7)cc(-c7ccccn7)n6)cc5)nc5ccccc5c4ccc3n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C46H29N7/c1-3-13-32(14-4-1)46-52-44-41(53(46)33-15-5-2-6-16-33)26-25-35-34-17-7-8-18-36(34)49-43(42(35)44)30-21-23-31(24-22-30)45-50-39(37-19-9-11-27-47-37)29-40(51-45)38-20-10-12-28-48-38/h1-29H |
| InChIKey | VQSNZYPIACBREJ-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.79 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|