C21H23ClN6O3 — CID 139498756
3-[(1R,3R)-3-[(3Z,5E)-5-chlorohepta-1,3,5-trien-2-yl]cyclopentyl]-5-[(7-methyl-6-oxopurin-1-yl)methyl]-1,3,4-oxadiazol-2-one (PubChem CID 139498756) has the molecular formula C21H23ClN6O3 and a molecular weight of 442.91 g/mol. Its IUPAC name is 3-[(1R,3R)-3-[(3Z,5E)-5-chlorohepta-1,3,5-trien-2-yl]cyclopentyl]-5-[(7-methyl-6-oxopurin-1-yl)methyl]-1,3,4-oxadiazol-2-one.
| Compound Name | 3-[(1R,3R)-3-[(3Z,5E)-5-chlorohepta-1,3,5-trien-2-yl]cyclopentyl]-5-[(7-methyl-6-oxopurin-1-yl)methyl]-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 139498756 |
| Molecular Formula | C21H23ClN6O3 |
| Molecular Weight | 442.91 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 3-[(1R,3R)-3-[(3Z,5E)-5-chlorohepta-1,3,5-trien-2-yl]cyclopentyl]-5-[(7-methyl-6-oxopurin-1-yl)methyl]-1,3,4-oxadiazol-2-one |
| SMILES | C=C(/C=C\C(Cl)=C/C)[C@@H]1CC[C@@H](n2nc(Cn3cnc4ncn(C)c4c3=O)oc2=O)C1 |
| InChI | InChI=1S/C21H23ClN6O3/c1-4-15(22)7-5-13(2)14-6-8-16(9-14)28-21(30)31-17(25-28)10-27-12-24-19-18(20(27)29)26(3)11-23-19/h4-5,7,11-12,14,16H,2,6,8-10H2,1,3H3/b7-5-,15-4+/t14-,16-/m1/s1 |
| InChIKey | MDHPAZVPJYDUKN-IFMZWZQTSA-N |
| XLogP | 2.92 |
| TPSA | 100.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.91 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|